| Compound Information | SONAR Target prediction |
| Name: | CYTARABINE |
| Unique Identifier: | SPE01500217 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 230.114 g/mol |
| X log p: | 2.451 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 41.9 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 8 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | NC1C=CN(C2OC(CO)C(O)C2O)C(=O)N=1 |
| Source: | synthetic |
| Therapeutics: | antineoplastic, antiviral, antimetabolite |
| Generic_name: | Cytarabine |
| Chemical_iupac_name: | 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1H-pyrimidin-2-one |
| Drug_type: | Approved Drug |
| Kegg_compound_id: | C02961 |
| Drugbank_id: | APRD00499 |
| Melting_point: | 212-213oC |
| H2o_solubility: | freely soluble |
| Logp: | -2.712 |
| Cas_registry_number: | 147-94-4 |
| Drug_category: | Immunosuppressive Agents; Antivirals; Antimetabolites; Antineoplastic Agents; ATC:L01BC01 |
| Indication: | For the treatment of acute non-lymphocytic leukemia, acute lymphocytic leukemia and blast phase of chronic myelocytic leukemia. |
| Pharmacology: | Cytarabine is an antineoplastic anti-metabolite used in the treatment of several forms of leukemia including acute myelogenous leukemia and meningeal leukemia. Anti-metabolites masquerade as purine or pyrimidine - which become the building blocks of DNA. They prevent these substances becoming incorporated in to DNA during the "S" phase (of the cell cycle), stopping normal development and division. Cytarabine is metabolized intracellularly into its active triphosphate form (cytosine arabinoside triphosphate). This metabolite then damages DNA by multiple mechanisms, including the inhibition of alpha-DNA polymerase, inhibition of DNA repair through an effect on beta-DNA polymerase, and incorporation into DNA. The latter mechanism is probably the most important. Cytotoxicity is highly specific for the S phase of the cell cycle. |
| Mechanism_of_action: | Cytarabine acts through direct DNA damage and incorporation into DNA. Cytarabine is cytotoxic to a wide variety of proliferating mammalian cells in culture. It exhibits cell phase specificity, primarily killing cells undergoing DNA synthesis (S-phase) and under certain conditions blocking the progression of cells from the G1 phase to the S-phase. Although the mechanism of action is not completely understood, it appears that cytarabine acts through the inhibition of DNA polymerase. A limited, but significant, incorporation of cytarabine into both DNA and RNA has also been reported. |
| Organisms_affected: | Humans and other mammals |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 91 92 93 94 95 96 97 98 99 100 Next >> [205] |
| Species: | 4932 |
| Condition: | VPS5 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8326±0.0019799 |
| Normalized OD Score: sc h | 1.0113±0.0042246 |
| Z-Score: | 0.6174±0.233797 |
| p-Value: | 0.542482 |
| Z-Factor: | -2.64709 |
| Fitness Defect: | 0.6116 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 23 | << Back 1 2 3 4 |
| 6480064 | 4-amino-1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| 6551012 | 4-amino-1-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| 6603781 | 4-amino-1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| 6713582 | 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| 11425092 | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| internal high similarity DBLink | Rows returned: 3 |
| BTB 15125 | 1.0000 |
| LOPAC 00787 | 1.0000 |
| SPE01503431 | 1.0000 |
| active | Cluster 3538 | Additional Members: 13 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory