| Compound Information | SONAR Target prediction |
| Name: | CORTISONE ACETATE |
| Unique Identifier: | SPE01500207 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 372.242 g/mol |
| X log p: | -0.534 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 77.51 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(=O)CC21C |
| Source: | semisynthetic |
| Therapeutics: | glucocorticoid |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 191 192 193 194 195 196 197 198 199 200 Next >> [205] |
| Species: | 4932 |
| Condition: | HOG1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6950±0.0226274 |
| Normalized OD Score: sc h | 0.9861±0.0139802 |
| Z-Score: | -0.3508±0.321698 |
| p-Value: | 0.732442 |
| Z-Factor: | -10.5963 |
| Fitness Defect: | 0.3114 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 16 | << Back 1 2 3 |
| 7059631 | [2-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 7067809 | [2-[(8S,9R,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 7067810 | [2-[(8S,9R,10R,13S,14R,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 7067811 | [2-[(8S,9S,10R,13S,14R,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| internal high similarity DBLink | Rows returned: 1 |
| LOPAC 00764 | 1.0000 |
| active | Cluster 11390 | Additional Members: 8 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory