| Compound Information | SONAR Target prediction | | Name: | CORTISONE ACETATE | | Unique Identifier: | SPE01500207 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 372.242 g/mol | | X log p: | -0.534 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 77.51 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(=O)CC21C | | Source: | semisynthetic | | Therapeutics: | glucocorticoid |
| Species: |
4932 |
| Condition: |
RVS167 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7495±0.00233345 |
| Normalized OD Score: sc h |
1.0333±0.0010451 |
| Z-Score: |
1.8551±0.125101 |
| p-Value: |
0.0646192 |
| Z-Factor: |
-5.17013 |
| Fitness Defect: |
2.7392 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 11|D6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.00 Celcius | | Date: | 2007-11-14 YYYY-MM-DD | | Plate CH Control (+): | 0.0408±0.00044 | | Plate DMSO Control (-): | 0.7152499999999999±0.18748 | | Plate Z-Factor: | 0.0723 |
|  png
ps
pdf |
| 7059631 |
[2-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop
enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 7067809 |
[2-[(8S,9R,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop
enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 7067810 |
[2-[(8S,9R,10R,13S,14R,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop
enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 7067811 |
[2-[(8S,9S,10R,13S,14R,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop
enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 11390 | Additional Members: 8 | Rows returned: 0 | |
|
