Compound Information | SONAR Target prediction | Name: | CORTISONE ACETATE | Unique Identifier: | SPE01500207 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 372.242 g/mol | X log p: | -0.534 (online calculus) | Lipinksi Failures | 0 | TPSA | 77.51 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(=O)CC21C | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4932 |
Condition: |
FAA2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6634±0.00940452 |
Normalized OD Score: sc h |
0.9919±0.00543315 |
Z-Score: |
-0.4382±0.268099 |
p-Value: |
0.666878 |
Z-Factor: |
-48.1081 |
Fitness Defect: |
0.4051 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 3|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.30 Celcius | Date: | 2008-05-27 YYYY-MM-DD | Plate CH Control (+): | 0.040325±0.00088 | Plate DMSO Control (-): | 0.662125±0.01272 | Plate Z-Factor: | 0.9145 |
| png ps pdf |
4254489 |
[2-(17-hydroxy-6,10,13-trimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17 -yl)-2-oxo-ethyl] acetate |
4521157 |
[2-(17-hydroxy-10,13-dimethyl-3,11-dioxo-4,5,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl )-2-oxo-ethyl] acetate |
5702028 |
[2-[(10R,13S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phe nanthren-17-yl]-2-oxo-ethyl] acetate |
6546962 |
[2-[(8S,9R,10R,13R,14S,17S)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
6603773 |
[2-[(8S,9S,10S,13R,14R,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
6957676 |
[2-[(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 11390 | Additional Members: 8 | Rows returned: 0 | |
|