Compound Information | SONAR Target prediction | Name: | CLOMIPHENE CITRATE | Unique Identifier: | SPE01500196 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 561.797 g/mol | X log p: | 30.354 (online calculus) | Lipinksi Failures | 1 | TPSA | 12.47 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 9 | Canonical Smiles: | CCN(CC)CCOc1ccc(cc1)C(=C(Cl)c1ccccc1)c1ccccc1.OC(=O)CC(O)(CC(O)=O)C(O) =O | Source: | synthetic | Therapeutics: | gonad stimulating principle |
Species: |
4932 |
Condition: |
SLT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7870±0.0282843 |
Normalized OD Score: sc h |
0.9239±0.00874798 |
Z-Score: |
-2.0944±0.225945 |
p-Value: |
0.0386122 |
Z-Factor: |
-0.163107 |
Fitness Defect: |
3.2542 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 12|D10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.08474999999999999±0.00317 | Plate DMSO Control (-): | 0.9512499999999999±0.01954 | Plate Z-Factor: | 0.8819 |
| png ps pdf |
DBLink | Rows returned: 3 | |
60974 |
2-[4-(2-chloro-1,2-diphenyl-ethenyl)phenoxy]-N,N-diethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
3033832 |
2-[4-[(E)-2-chloro-1,2-diphenyl-ethenyl]phenoxy]-N,N-diethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
6420009 |
2-[4-[(E)-2-chloro-1,2-diphenyl-ethenyl]phenoxy]-N,N-diethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 3471 | Additional Members: 6 | Rows returned: 3 | |
|