| Compound Information | SONAR Target prediction |
| Name: | CHLORTETRACYCLINE HYDROCHLORIDE |
| Unique Identifier: | SPE01500186 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 455.697 g/mol |
| X log p: | 3.2 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 54.45 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 10 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | CN(C)C1C2CC3C(=C(O)C2(O)C(=O)C(C(N)=O)=C1O)C(=O)c1c(O)ccc(Cl)c1C3(C)O |
| Class: | quinone |
| Source: | Streptomyces aureofaciens |
| Reference: | Ann NY Acad Sci 51: 177 (1948); JACS 74: 4976 (1952); 76: 3568 (1954) |
| Therapeutics: | antibacterial, antiamebic, Ca chelator, hepatotoxic; inhibits protein synthesis |
| Generic_name: | 7-CHLOROTETRACYCLINE |
| Chemical_iupac_name: | 7-CHLOROTETRACYCLINE |
| Drug_type: | Experimental |
| Drugbank_id: | EXPT01049 |
| Drug_category: | Tetracycline Repressor inhibitor |
| Organisms_affected: | -1 |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [205] |
| Species: | 4932 |
| Condition: | SLT2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8805±0.00190919 |
| Normalized OD Score: sc h | 1.0209±0.00340923 |
| Z-Score: | 0.3371±0.167649 |
| p-Value: | 0.737858 |
| Z-Factor: | -6.54796 |
| Fitness Defect: | 0.304 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 5 |
| SPE01500457 | 0.9146 |
| SPE01500566 | 0.9298 |
| LOPAC 00845 | 1.0000 |
| SPE01500226 | 1.0000 |
| SPE01500829 | 1.0000 |
| nonactive | Cluster 12393 | Additional Members: 20 | Rows returned: 16 | 1 2 3 Next >> |
| LOPAC 00607 | 0.554347826086957 |
| LAT004C03 | 0.554347826086957 |
| SPE01505684 | 0.452631578947368 |
| SPE01500414 | 0.448275862068966 |
| Prest626 | 0.448275862068966 |
| Prest235 | 0.353658536585366 |
Service provided by the
Mike Tyers Laboratory