| Compound Information | SONAR Target prediction |
| Name: | CHLORTETRACYCLINE HYDROCHLORIDE |
| Unique Identifier: | SPE01500186 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 455.697 g/mol |
| X log p: | 3.2 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 54.45 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 10 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | CN(C)C1C2CC3C(=C(O)C2(O)C(=O)C(C(N)=O)=C1O)C(=O)c1c(O)ccc(Cl)c1C3(C)O |
| Class: | quinone |
| Source: | Streptomyces aureofaciens |
| Reference: | Ann NY Acad Sci 51: 177 (1948); JACS 74: 4976 (1952); 76: 3568 (1954) |
| Therapeutics: | antibacterial, antiamebic, Ca chelator, hepatotoxic; inhibits protein synthesis |
| Generic_name: | 7-CHLOROTETRACYCLINE |
| Chemical_iupac_name: | 7-CHLOROTETRACYCLINE |
| Drug_type: | Experimental |
| Drugbank_id: | EXPT01049 |
| Drug_category: | Tetracycline Repressor inhibitor |
| Organisms_affected: | -1 |