| Compound Information | SONAR Target prediction | | Name: | CHLORPROMAZINE | | Unique Identifier: | SPE01500184 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 299.714 g/mol | | X log p: | 16.565 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 31.78 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc12 | | Source: | synthetic | | Therapeutics: | antiemetic, antipsychotic | | Generic_name: | Chlorpromazine | | Chemical_iupac_name: | 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-propan-1-amine | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA448964 | | Kegg_compound_id: | C06906 | | Drugbank_id: | APRD00482 | | Melting_point: | < 25 oC | | H2o_solubility: | 2.55 mg/L | | Logp: | 5.512 | | Isoelectric_point: | 9.3 | | Cas_registry_number: | 50-53-3 | | Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C50533&Index=0&Type=Mass&Large=on | | Drug_category: | Antipsychotics; Antiemetics; Dopamine Antagonists; Phenothiazines; ATC:N05AA01 | | Indication: | For the treatment of schizophrenia, control nausea and vomiting, For relief of restlessness and apprehension before surgery, adjunct in the treatment of tetanus, control the manifestations of the manic type of manic-depressive illness. | | Pharmacology: | Chlorpromazine is a psychotropic agent indicated for the treatment of schizophrenia. It also exerts sedative and antiemetic activity. Chlorpromazine has actions at all levels of the central nervous system-primarily at subcortical levels-as well as on multiple organ systems. Chlorpromazine has strong antiadrenergic and weaker peripheral anticholinergic activity; ganglionic blocking action is relatively slight. It also possesses slight antihistaminic and antiserotonin activity. | | Mechanism_of_action: | Chlorpromazine acts as an antagonist (blocking agent) on different postsysnaptic receptors -on dopaminergic-receptors (subtypes D1, D2, D3 and D4 - different antipsychotic properties on productive and unproductive symptoms), on serotonergic-receptors (5-HT1 and 5-HT2, with anxiolytic, antidepressive and antiaggressive properties as well as an attenuation of extrapypramidal side-effects, but also leading to weight gain, fall in blood pressure, sedation and ejaculation difficulties), on histaminergic-receptors (H1-receptors, sedation, antiemesis, vertigo, fall in blood pressure and weight gain), alpha1/alpha2-receptors (antisympathomimetic properties, lowering of blood pressure, reflex tachycardia, vertigo, sedation, hypersalivation and incontinence as well as sexual dysfunction, but may also attenuate pseudoparkinsonism - controversial) and finally on muscarinic (cholinergic) M1/M2-receptors (causing anticholinergic symptoms like dry mouth, blurred vision, obstipation, difficulty/inability to urinate, sinus tachycardia, ECG-changes and loss of memory, but the anticholinergic action may attenuate extrapyramidal side-effects).Additionally, Chlorpromazine is a weak presynaptic inhibitor of Dopamine reuptake, which may lead to (mild) antidepressive and antiparkinsonian effects. This action could also account for psychomotor agitation and amplification of psychosis (very rarely noted in clinical use). | | Organisms_affected: | Humans and other mammals |
| Species: |
4932 |
| Condition: |
SPE01504082 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5320±0.00820244 |
| Normalized OD Score: sc h |
1.0066±0.0179342 |
| Z-Score: |
0.1645±0.519665 |
| p-Value: |
0.71696 |
| Z-Factor: |
-3.37413 |
| Fitness Defect: |
0.3327 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 1|G7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.10 Celcius | | Date: | 2006-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.040425±0.00730 | | Plate DMSO Control (-): | 0.565075±0.20738 | | Plate Z-Factor: | 0.0546 |
| png ps pdf |
| 2726 |
3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine |
| 6240 |
3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine hydrochloride |
| 9682 |
3-(2-chlorophenothiazin-10-yl)propyl-trimethyl-azanium iodide |
| 9683 |
3-(2-chlorophenothiazin-10-yl)propyl-trimethyl-azanium |
| 29745 |
3-(2-chlorophenothiazin-10-yl)propyl-trimethyl-azanium chloride |
| 62875 |
3-(2-chlorophenothiazin-10-yl)-N-methyl-propan-1-amine |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 17541 | Additional Members: 13 | Rows returned: 3 | |
|