| Compound Information | SONAR Target prediction |  | Name: | BETAMETHASONE VALERATE |  | Unique Identifier: | SPE01500145  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 439.284 g/mol |  | X log p: | 4.049  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CCCCC(=O)OC1(C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)C(=O)CO |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		NTH1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7089±0.000919239 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9860±0.00859643 | 
	 
	
		| Z-Score: | 
		-0.7387±0.495922 | 
	 
	
		| p-Value: | 
		0.486982 | 
	 
	
		| Z-Factor: | 
		-9.14455 | 
	 
	
		| Fitness Defect: | 
		0.7195 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 3|G3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.00 Celcius |  | Date: | 2008-01-23 YYYY-MM-DD |  | Plate CH Control (+): | 0.04095±0.00049 |  | Plate DMSO Control (-): | 0.684075±0.01902 |  | Plate Z-Factor: | 0.9197 |  
  |  png ps pdf |  
 
 
	
		| 16533 | 
		[(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate | 
	 
	
		| 63045 | 
		[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate | 
	 
	
		| 63047 | 
		[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate | 
	 
	
		| 93007 | 
		[(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate | 
	 
	
		| 171259 | 
		[(8S,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11 ,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate | 
	 
	
		| 578771 | 
		[9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclope nta[a]phenanthren-17-yl] pentanoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 |  |   
 
 |