| 
 | Compound Information | SONAR Target prediction |  | Name: | BETAMETHASONE VALERATE |  | Unique Identifier: | SPE01500145 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 439.284 g/mol |  | X log p: | 4.049  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CCCCC(=O)OC1(C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)C(=O)CO |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid | 
 
 
	
		| Species: | 4932 |  
		| Condition: | DOA4 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6090±0.0106066 |  
		| Normalized OD Score: sc h | 0.9684±0.00961456 |  
		| Z-Score: | -1.2485±0.355877 |  
		| p-Value: | 0.226188 |  
		| Z-Factor: | -1.71323 |  
		| Fitness Defect: | 1.4864 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 3|G3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.40 Celcius |  | Date: | 2008-05-02 YYYY-MM-DD |  | Plate CH Control (+): | 0.041125±0.00106 |  | Plate DMSO Control (-): | 0.59405±0.01786 |  | Plate Z-Factor: | 0.8958 | 
 |  png ps
 pdf
 | 
 
 
	
		| 16533 | [(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate
 |  
		| 63045 | [(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate
 |  
		| 63047 | [(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate
 |  
		| 93007 | [(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate
 |  
		| 171259 | [(8S,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11 ,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate
 |  
		| 578771 | [9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclope nta[a]phenanthren-17-yl] pentanoate
 |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 |  | 
 
 |