Compound Information | SONAR Target prediction | Name: | BETAMETHASONE VALERATE | Unique Identifier: | SPE01500145 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 439.284 g/mol | X log p: | 4.049 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 7 | Canonical Smiles: | CCCCC(=O)OC1(C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)C(=O)CO | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.7155±0.00268701 |
Normalized OD Score: sc h |
1.0053±0.00390104 |
Z-Score: |
0.1813±0.139899 |
p-Value: |
0.856848 |
Z-Factor: |
-7.12577 |
Fitness Defect: |
0.1545 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 10|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.40 Celcius | Date: | 2006-02-22 YYYY-MM-DD | Plate CH Control (+): | 0.040775000000000006±0.00103 | Plate DMSO Control (-): | 0.68765±0.01434 | Plate Z-Factor: | 0.9423 |
| png ps pdf |
16533 |
[(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
63045 |
[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
63047 |
[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
93007 |
[(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
171259 |
[(8S,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11 ,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
578771 |
[9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclope nta[a]phenanthren-17-yl] pentanoate |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 | |
|