| 
 | Compound Information | SONAR Target prediction |  | Name: | BETAMETHASONE VALERATE |  | Unique Identifier: | SPE01500145 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 439.284 g/mol |  | X log p: | 4.049  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CCCCC(=O)OC1(C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)C(=O)CO |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid | 
 
 
	
		| Species: | 4932 |  
		| Condition: | ARD1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.3856±0.0000707107 |  
		| Normalized OD Score: sc h | 0.9956±0.0107452 |  
		| Z-Score: | -0.0954±0.247178 |  
		| p-Value: | 0.861876 |  
		| Z-Factor: | -152.9 |  
		| Fitness Defect: | 0.1486 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 3|G3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.60 Celcius |  | Date: | 2008-07-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.04095±0.00086 |  | Plate DMSO Control (-): | 0.3712±0.01320 |  | Plate Z-Factor: | 0.8820 | 
 |  png ps
 pdf
 | 
 
 
	
		| 5702013 | [(9R,11S)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahyd rocyclopenta[a]phenanthren-17-yl] pentanoate
 |  
		| 6564090 | [(8R,9R,10R,11S,13R,14R,16R,17S)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate
 |  
		| 6710678 | [(9R,10S,13S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,1 5,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate
 |  
		| 7061367 | [(8R,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate
 |  
		| 7061368 | [(8R,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate
 |  
		| 7061369 | [(8R,9R,10S,11S,13S,14R,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate
 |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 |  | 
 
 |