| Compound Information | SONAR Target prediction |  | Name: | BETAMETHASONE VALERATE |  | Unique Identifier: | SPE01500145  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 439.284 g/mol |  | X log p: | 4.049  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CCCCC(=O)OC1(C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)C(=O)CO |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RPL9B | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7842±0.00834386 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9638±0.00498853 | 
	 
	
		| Z-Score: | 
		-1.0810±0.200533 | 
	 
	
		| p-Value: | 
		0.284514 | 
	 
	
		| Z-Factor: | 
		-3.7629 | 
	 
	
		| Fitness Defect: | 
		1.257 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 10|G6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.70 Celcius |  | Date: | 2006-03-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.038925±0.00104 |  | Plate DMSO Control (-): | 0.801625±0.03180 |  | Plate Z-Factor: | 0.8668 |  
  |  png ps pdf |  
 
 
	
		| 5702013 | 
		[(9R,11S)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahyd rocyclopenta[a]phenanthren-17-yl] pentanoate | 
	 
	
		| 6564090 | 
		[(8R,9R,10R,11S,13R,14R,16R,17S)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate | 
	 
	
		| 6710678 | 
		[(9R,10S,13S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,1 5,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate | 
	 
	
		| 7061367 | 
		[(8R,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate | 
	 
	
		| 7061368 | 
		[(8R,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate | 
	 
	
		| 7061369 | 
		[(8R,9R,10S,11S,13S,14R,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 |  |   
 
 |