| Compound Information | SONAR Target prediction | | Name: | BETAMETHASONE VALERATE | | Unique Identifier: | SPE01500145 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 439.284 g/mol | | X log p: | 4.049 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CCCCC(=O)OC1(C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)C(=O)CO | | Source: | semisynthetic | | Therapeutics: | glucocorticoid |
| Species: |
4932 |
| Condition: |
HOC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6163±0.00700036 |
| Normalized OD Score: sc h |
0.9916±0.00171013 |
| Z-Score: |
-0.2863±0.0957411 |
| p-Value: |
0.775116 |
| Z-Factor: |
-5.19405 |
| Fitness Defect: |
0.2547 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 10|G6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2006-02-14 YYYY-MM-DD | | Plate CH Control (+): | 0.039425±0.00107 | | Plate DMSO Control (-): | 0.612475±0.00979 | | Plate Z-Factor: | 0.9473 |
| png ps pdf |
| 5702013 |
[(9R,11S)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahyd rocyclopenta[a]phenanthren-17-yl] pentanoate |
| 6564090 |
[(8R,9R,10R,11S,13R,14R,16R,17S)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| 6710678 |
[(9R,10S,13S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,1 5,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| 7061367 |
[(8R,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| 7061368 |
[(8R,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| 7061369 |
[(8R,9R,10S,11S,13S,14R,16R,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 | |
|