| 
 | Compound Information | SONAR Target prediction |  | Name: | BETAMETHASONE |  | Unique Identifier: | SPE01500144 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 363.231 g/mol |  | X log p: | 4.005  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)CO |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid, antiinflammatory |  | Generic_name: | Betamethasone |  | Chemical_iupac_name: | 9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,9,10,11,12,13 ,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
 |  | Drug_type: | Approved Drug |  | Pharmgkb_id: | PA448605 |  | Kegg_compound_id: | C06848 |  | Drugbank_id: | APRD00513 |  | Melting_point: | 231-234oC |  | H2o_solubility: | Insoluble |  | Logp: | 1.772 |  | Cas_registry_number: | 378-44-9 |  | Drug_category: | Corticosteroid; Glucocorticoids; Anti-inflammatory, steroidal; Immunosuppressants; ATC:A07EA04; ATC:C05AA05; ATC:D07AC01; ATC:D07XC01; ATC:H02AB01; ATC:R01AD06;
 ATC:R03BA04; ATC:S01BA06; ATC:S01CB04; ATC:S02BA07; ATC:S03BA03
 |  | Indication: | Topical use (cream, lotion and ointment): for relief of the inflammatory and pruritic manifestations of corticosteroid-responsive dermatoses
 Topical use (foam): relief of the inflammatory and pruritic manifestations of
 corticosteroid-responsive dermatoses of the scalp
 Systemic use: for the treatment of edocrine disorders, rheumatic disorders,
 collagen diseases, dermatological diseases, allergic states, ophthalmic diseases,
 respiratory diseases, hematologic disorders, neoplastic diseases, edematous states,
 gastrointestinal diseases, tuberculous meningitis and trichinosis.
 |  | Pharmacology: | Betamethasone and its derivatives, betamethasone sodium phosphate and betamethasone acetate, are synthetic glucocorticoids. Used for its antiinflammatory or
 immunosuppressive properties, betamethasone is combined with a mineralocorticoid to
 manage adrenal insufficiency and is used in the form of betamethasone benzoate,
 betamethasone dipropionate, or betamethasone valerate for the treatment of
 inflammation due to corticosteroid-responsive dermatoses. Betamethasone and
 clotrimazole are used together to treat cutaneous tinea infections.
 |  | Mechanism_of_action: | Betamethasone is a glucocorticoid receptor agonist. The antiinflammatory actions of corticosteroids are thought to involve lipocortins, phospholipase A2 inhibitory
 proteins which, through inhibition arachidonic acid, control the biosynthesis of
 prostaglandins and leukotrienes. The immune system is suppressed by corticosteroids
 due to a decrease in the function of the lymphatic system, a reduction in
 immunoglobulin and complement concentrations, the precipitation of lymphocytopenia,
 and interference with antigen-antibody binding. Betamethasone binds to plasma
 transcortin, and it becomes active when it is not bound to transcortin.
 |  | Organisms_affected: | Humans and other mammals | 
 
 
	
		| Species: | 4932 |  
		| Condition: | ARD1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.3748±0.00579828 |  
		| Normalized OD Score: sc h | 0.9535±0.0143471 |  
		| Z-Score: | -1.1881±0.334942 |  
		| p-Value: | 0.247832 |  
		| Z-Factor: | -1.93051 |  
		| Fitness Defect: | 1.395 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 7|H3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.70 Celcius |  | Date: | 2008-07-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.04125±0.00071 |  | Plate DMSO Control (-): | 0.365675±0.01251 |  | Plate Z-Factor: | 0.8701 | 
 |  png ps
 pdf
 | 
 
 
	
		| 3003 | 9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopent a[a]phenanthren-3-one
 |  
		| 5743 | (8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
 |  
		| 9562 | (9R,11S)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocycl openta[a]phenanthren-3-one
 |  
		| 9782 | (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
 |  
		| 127516 | (8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12,14, 15,16-octahydrocyclopenta[a]phenanthren-3-one
 |  
		| 134644 | disodium (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15
 ,16-octahydrocyclopenta[a]phenanthrene-11,17-diolate
 |  
 | internal high similarity DBLink  | Rows returned: 4 |  | 
 
 
 |