| Compound Information | SONAR Target prediction |
| Name: | AMILORIDE HYDROCHLORIDE |
| Unique Identifier: | SPE01500112 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 257.016 g/mol |
| X log p: | -2.813 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 41.79 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 8 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | Cl.NC(=N)NC(=O)c1nc(Cl)c(N)nc1N |
| Source: | synthetic |
| Reference: | Biochim Biophys Acta 944: 383 (1988) |
| Therapeutics: | Na+ channel inhibitor, diuretic |
| Found: 2 active | as graph: single | with analogs | 1 2 Next >> |
| Species: | 4932 |
| Condition: | YPT6 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5407±0.0120915 |
| Normalized OD Score: sc h | 1.4088±0.0512321 |
| Z-Score: | 4.1383±0.0575111 |
| p-Value: | 0.0000355106 |
| Z-Factor: | 0.28067 |
| Fitness Defect: | 10.2457 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 2 |
| SPE01503999 | 0.9016 |
| LOPAC 00165 | 1.0000 |
| active | Cluster 4060 | Additional Members: 8 | Rows returned: 1 |
| SPE01504215 | 0.462962962962963 |
Service provided by the
Mike Tyers Laboratory