| Compound Information | SONAR Target prediction |
| Name: | ACETYLCHOLINE |
| Unique Identifier: | SPE01500104 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 165.533 g/mol |
| X log p: | 0.00600000000000001 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 26.3 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 2 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | [ClH-].CC(=O)OCC[N+](C)(C)C |
| Source: | synthetic |
| Therapeutics: | antiarrhythmic, miotic, vasodilator (peripheral) |
| Generic_name: | ACETYLCHOLINE |
| Chemical_iupac_name: | ACETYLCHOLINE |
| Drug_type: | Experimental |
| Kegg_compound_id: | C01996 |
| Drugbank_id: | EXPT00412 |
| Logp: | -3.9 +/- 0.36 |
| Cas_registry_number: | 51-84-3 |
| Drug_category: | Acetylcholinesterase inhibitor |
| Organisms_affected: | -1 |