| Compound Information | SONAR Target prediction |
| Name: | HAEMATOMMIC ACID |
| Unique Identifier: | SPE01400131 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 188.093 g/mol |
| X log p: | 3.966 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 34.14 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | Cc1cc(O)c(C=O)c(O)c1C(O)=O |
| Class: | aromatic |
| Source: | Alectoria spp, Haematomma spp and Lethariella spp |
| Reference: | J Org Chem 42: 2526 (1977); Helv Chim Acta 72: 1061 (1989) |
| Found: 3 active | as graph: single | with analogs | 1 2 3 Next >> |
| Species: | 4932 |
| Condition: | BY4741-3rd |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7054±0.0282843 |
| Normalized OD Score: sc h | 0.9141±0.0180508 |
| Z-Score: | -4.2035±1.22182 |
| p-Value: | 0.000419814 |
| Z-Factor: | -0.228327 |
| Fitness Defect: | 7.7757 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 6710680 | 3-formyl-2,4-dihydroxy-6-methyl-benzoic acid |
| internal high similarity DBLink | Rows returned: 1 |
| SPE00200640 | 0.9259 |
| active | Cluster 3139 | Additional Members: 3 | Rows returned: 1 |
| SPE00205071 | 0.446808510638298 |
Service provided by the
Mike Tyers Laboratory