Compound Information | SONAR Target prediction | Name: | RHAMNETIN | Unique Identifier: | SPE00310031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 304.167 g/mol | X log p: | 11.872 (online calculus) | Lipinksi Failures | 1 | TPSA | 35.53 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 2 | Canonical Smiles: | COc1cc(O)c2C(=O)C(O)=C(Oc2c1)c1ccc(O)c(O)c1 | Class: | flavone | Source: | Rhamnus cathartica | Reference: | J Chem Soc 105: 2354 (1914) |
Species: |
4932 |
Condition: |
RBL2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6402±0.0173948 |
Normalized OD Score: sc h |
0.8830±0.0188923 |
Z-Score: |
-6.5612±0.957181 |
p-Value: |
0.00000000199821 |
Z-Factor: |
-0.0388281 |
Fitness Defect: |
20.031 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|E11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2008-06-03 YYYY-MM-DD | Plate CH Control (+): | 0.04075±0.00120 | Plate DMSO Control (-): | 0.709975±0.01689 | Plate Z-Factor: | 0.9173 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5281691 |
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-chromen-4-one |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 6267 | Additional Members: 3 | Rows returned: 1 | |
|