| Compound Information | SONAR Target prediction | | Name: | RHAMNETIN | | Unique Identifier: | SPE00310031 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 304.167 g/mol | | X log p: | 11.872 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | COc1cc(O)c2C(=O)C(O)=C(Oc2c1)c1ccc(O)c(O)c1 | | Class: | flavone | | Source: | Rhamnus cathartica | | Reference: | J Chem Soc 105: 2354 (1914) |
| Species: |
4932 |
| Condition: |
MCM21 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6566±0.0116673 |
| Normalized OD Score: sc h |
0.9857±0.00592648 |
| Z-Score: |
-0.6952±0.25339 |
| p-Value: |
0.49388 |
| Z-Factor: |
-253.086 |
| Fitness Defect: |
0.7055 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|D3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.00 Celcius | | Date: | 2007-11-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04075±0.00116 | | Plate DMSO Control (-): | 0.6565000000000001±0.03669 | | Plate Z-Factor: | 0.8008 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5281691 |
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-chromen-4-one |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 6267 | Additional Members: 3 | Rows returned: 1 | |
|