| 
 | Compound Information | SONAR Target prediction |  | Name: | RHAMNETIN |  | Unique Identifier: | SPE00310031 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 304.167 g/mol |  | X log p: | 11.872  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | COc1cc(O)c2C(=O)C(O)=C(Oc2c1)c1ccc(O)c(O)c1 |  | Class: | flavone |  | Source: | Rhamnus cathartica |  | Reference: | J Chem Soc 105: 2354 (1914) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BIM1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6117±0.0222739 |  
		| Normalized OD Score: sc h | 0.8947±0.0253711 |  
		| Z-Score: | -5.3545±0.860719 |  
		| p-Value: | 0.00000103903 |  
		| Z-Factor: | -1.04414 |  
		| Fitness Defect: | 13.7772 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 9|E11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.10 Celcius |  | Date: | 2008-06-24 YYYY-MM-DD |  | Plate CH Control (+): | 0.0399±0.00062 |  | Plate DMSO Control (-): | 0.6641250000000001±0.02617 |  | Plate Z-Factor: | 0.8357 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 5281691 | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-chromen-4-one |  
 | internal high similarity DBLink  | Rows returned: 9 | << Back 1 2 | 
 
 | active | Cluster 6267 | Additional Members: 3 | Rows returned: 1 |  | 
 
 |