| Compound Information | SONAR Target prediction |  | Name: | CEDRYL ACETATE |  | Unique Identifier: | SPE00310015  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 237.189 g/mol |  | X log p: | 0.538  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)OC(C)=O |  | Class: | sesquiterpene |  | Source: | semisynthetic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SAP30 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6892±0.0144957 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9825±0.00941368 | 
	 
	
		| Z-Score: | 
		-0.6076±0.286499 | 
	 
	
		| p-Value: | 
		0.551654 | 
	 
	
		| Z-Factor: | 
		-4.29422 | 
	 
	
		| Fitness Defect: | 
		0.5948 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 7|C8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 21.90 Celcius |  | Date: | 2006-03-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.0393±0.00111 |  | Plate DMSO Control (-): | 0.6837±0.01084 |  | Plate Z-Factor: | 0.9306 |  
  |  png ps pdf |  
 
 
	
		| 6448 | 
		(1,7,7-trimethylnorbornan-2-yl) acetate | 
	 
	
		| 6482 | 
		n/a | 
	 
	
		| 6631 | 
		2-(4-methylcyclohexyl)propan-2-yl acetate | 
	 
	
		| 7635 | 
		2-ethylhexyl acetate | 
	 
	
		| 8159 | 
		heptyl acetate | 
	 
	
		| 8164 | 
		octyl acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 6 |  |   
 |  active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 |  |   
 
 |