Compound Information | SONAR Target prediction | Name: | CEDRYL ACETATE | Unique Identifier: | SPE00310015 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 237.189 g/mol | X log p: | 0.538 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)OC(C)=O | Class: | sesquiterpene | Source: | semisynthetic |
Species: |
4932 |
Condition: |
POL32 |
Replicates: |
2 |
Raw OD Value: r im |
0.5695±0.0321026 |
Normalized OD Score: sc h |
0.9947±0.0025874 |
Z-Score: |
-0.1488±0.0721204 |
p-Value: |
0.881888 |
Z-Factor: |
-107.269 |
Fitness Defect: |
0.1257 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 7|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2006-02-16 YYYY-MM-DD | Plate CH Control (+): | 0.039099999999999996±0.00068 | Plate DMSO Control (-): | 0.565025±0.02016 | Plate Z-Factor: | 0.8555 |
| png ps pdf |
6448 |
(1,7,7-trimethylnorbornan-2-yl) acetate |
6482 |
n/a |
6631 |
2-(4-methylcyclohexyl)propan-2-yl acetate |
7635 |
2-ethylhexyl acetate |
8159 |
heptyl acetate |
8164 |
octyl acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|