Compound Information | SONAR Target prediction | Name: | CEDRYL ACETATE | Unique Identifier: | SPE00310015 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 237.189 g/mol | X log p: | 0.538 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)OC(C)=O | Class: | sesquiterpene | Source: | semisynthetic |
Species: |
4932 |
Condition: |
ARX1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6491±0.0114551 |
Normalized OD Score: sc h |
1.0225±0.00380963 |
Z-Score: |
1.1023±0.0938881 |
p-Value: |
0.271364 |
Z-Factor: |
-4.41734 |
Fitness Defect: |
1.3043 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 7|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2007-10-11 YYYY-MM-DD | Plate CH Control (+): | 0.040249999999999994±0.00220 | Plate DMSO Control (-): | 0.6352500000000001±0.02646 | Plate Z-Factor: | 0.8599 |
| png ps pdf |
6448 |
(1,7,7-trimethylnorbornan-2-yl) acetate |
6482 |
n/a |
6631 |
2-(4-methylcyclohexyl)propan-2-yl acetate |
7635 |
2-ethylhexyl acetate |
8159 |
heptyl acetate |
8164 |
octyl acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|