Compound Information | SONAR Target prediction | Name: | CEDRYL ACETATE | Unique Identifier: | SPE00310015 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 237.189 g/mol | X log p: | 0.538 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)OC(C)=O | Class: | sesquiterpene | Source: | semisynthetic |
Species: |
4932 |
Condition: |
HOG1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5960±0.0169706 |
Normalized OD Score: sc h |
0.9114±0.0178237 |
Z-Score: |
-2.4841±0.898206 |
p-Value: |
0.0331376 |
Z-Factor: |
-1.06428 |
Fitness Defect: |
3.4071 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 17|E11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.0915±0.00763 | Plate DMSO Control (-): | 0.8047500000000001±0.03659 | Plate Z-Factor: | 0.7547 |
| png ps pdf |
6448 |
(1,7,7-trimethylnorbornan-2-yl) acetate |
6482 |
n/a |
6631 |
2-(4-methylcyclohexyl)propan-2-yl acetate |
7635 |
2-ethylhexyl acetate |
8159 |
heptyl acetate |
8164 |
octyl acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|