| 
 | Compound Information | SONAR Target prediction |  | Name: | CEDRYL ACETATE |  | Unique Identifier: | SPE00310015 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 237.189 g/mol |  | X log p: | 0.538  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)OC(C)=O |  | Class: | sesquiterpene |  | Source: | semisynthetic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | MT2481-pdr1pdr3 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5809±0.035921 |  
		| Normalized OD Score: sc h | 0.8417±0.0466805 |  
		| Z-Score: | -5.0083±1.36546 |  
		| p-Value: | 0.0000264112 |  
		| Z-Factor: | -0.269027 |  
		| Fitness Defect: | 10.5417 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 7|C8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.40 Celcius |  | Date: | 2006-05-02 YYYY-MM-DD |  | Plate CH Control (+): | 0.0377±0.00156 |  | Plate DMSO Control (-): | 0.6723±0.01248 |  | Plate Z-Factor: | 0.9314 | 
 |  png ps
 pdf
 | 
 
 
	
		| 417399 | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[ a]phenanthren-3-yl] acetate
 |  
		| 428882 | n/a |  
		| 429145 | n/a |  
		| 441680 | n/a |  
		| 442460 | [(2R)-1,7,7-trimethylnorbornan-2-yl] acetate |  
		| 443131 | [(2S)-1,7,7-trimethylnorbornan-2-yl] acetate |  
 | internal high similarity DBLink  | Rows returned: 6 |  | 
 
 | active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 |  | 
 
 |