Compound Information | SONAR Target prediction | Name: | CEDRYL ACETATE | Unique Identifier: | SPE00310015 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 237.189 g/mol | X log p: | 0.538 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)OC(C)=O | Class: | sesquiterpene | Source: | semisynthetic |
Species: |
4932 |
Condition: |
SER1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4839±0.000636396 |
Normalized OD Score: sc h |
0.8458±0.00126701 |
Z-Score: |
-4.8582±0.173262 |
p-Value: |
0.00000140855 |
Z-Factor: |
-0.392259 |
Fitness Defect: |
13.4729 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 7|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.70 Celcius | Date: | 2007-09-17 YYYY-MM-DD | Plate CH Control (+): | 0.039675±0.00042 | Plate DMSO Control (-): | 0.5687500000000001±0.03760 | Plate Z-Factor: | 0.7716 |
| png ps pdf |
15605 |
undecyl acetate |
25324 |
decalin-2-yl acetate |
27867 |
(5-methyl-2-propan-2-yl-cyclohexyl) acetate |
30249 |
3,7-dimethyloctyl acetate |
30771 |
2-cyclohexylethyl acetate |
36081 |
(4-tert-butylcyclohexyl) acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|