Compound Information | SONAR Target prediction | Name: | CEDRYL ACETATE | Unique Identifier: | SPE00310015 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 237.189 g/mol | X log p: | 0.538 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)OC(C)=O | Class: | sesquiterpene | Source: | semisynthetic |
Species: |
4932 |
Condition: |
MT2481-pdr1pdr3 |
Replicates: |
2 |
Raw OD Value: r im |
0.5809±0.035921 |
Normalized OD Score: sc h |
0.8417±0.0466805 |
Z-Score: |
-5.0083±1.36546 |
p-Value: |
0.0000264112 |
Z-Factor: |
-0.269027 |
Fitness Defect: |
10.5417 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 7|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.40 Celcius | Date: | 2006-05-02 YYYY-MM-DD | Plate CH Control (+): | 0.0377±0.00156 | Plate DMSO Control (-): | 0.6723±0.01248 | Plate Z-Factor: | 0.9314 |
| png ps pdf |
228143 |
2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl acetate |
228299 |
(3-ethylcyclohexyl) acetate |
228301 |
(4-ethylcyclohexyl) acetate |
228302 |
(2-propan-2-ylcyclohexyl) acetate |
228303 |
(4-propan-2-ylcyclohexyl) acetate |
228305 |
(3-methyl-2-propan-2-yl-cyclohexyl) acetate |
internal high similarity DBLink | Rows returned: 6 | |
nonactive | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|