Compound Information | SONAR Target prediction | Name: | CEDRYL ACETATE | Unique Identifier: | SPE00310015 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 237.189 g/mol | X log p: | 0.538 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)OC(C)=O | Class: | sesquiterpene | Source: | semisynthetic |
Species: |
4932 |
Condition: |
APC9 |
Replicates: |
2 |
Raw OD Value: r im |
0.7068±0.00226274 |
Normalized OD Score: sc h |
1.0125±0.000488649 |
Z-Score: |
0.6778±0.0163275 |
p-Value: |
0.497946 |
Z-Factor: |
-3.91762 |
Fitness Defect: |
0.6973 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 7|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.90 Celcius | Date: | 2007-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.041675000000000004±0.00061 | Plate DMSO Control (-): | 0.68065±0.01793 | Plate Z-Factor: | 0.9085 |
| png ps pdf |
221745 |
(2-cyclohexylcyclohexyl) acetate |
222828 |
[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-12-acetyloxy-17-[(2R)-4-hydroxybutan-2-yl]-10,13-dimethyl-2,3,4,5,6,7 ,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
224008 |
[(3S,5S,8R,9S,10S,13S,14S,17S)-17-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahy dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
226596 |
(2,5-diethylcyclopentyl) acetate |
227634 |
(6-acetyloxy-3,7-dimethyl-octyl) acetate |
228141 |
2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-yl acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|