Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
ARL3 |
Replicates: |
2 |
Raw OD Value: r im |
0.4752±0.0390323 |
Normalized OD Score: sc h |
0.7070±0.050344 |
Z-Score: |
-13.7816±1.8624 |
p-Value: |
5.81592e-36 |
Z-Factor: |
0.338084 |
Fitness Defect: |
81.1325 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2008-06-11 YYYY-MM-DD | Plate CH Control (+): | 0.0402±0.00065 | Plate DMSO Control (-): | 0.671975±0.00932 | Plate Z-Factor: | 0.9688 |
| png ps pdf |
957 |
octan-1-ol |
1107 |
2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-3-ol |
1213 |
4,8a-dimethyldecalin-4a-ol |
1254 |
5-methyl-2-propan-2-yl-cyclohexan-1-ol |
2682 |
hexadecan-1-ol |
3240 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a ]phenanthren-3-ol |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|