Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
HSP104 |
Replicates: |
2 |
Raw OD Value: r im |
0.5245±0.113844 |
Normalized OD Score: sc h |
0.7470±0.153496 |
Z-Score: |
-14.3840±8.43494 |
p-Value: |
1.88951e-17 |
Z-Factor: |
-1.03391 |
Fitness Defect: |
38.5076 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.40 Celcius | Date: | 2008-04-11 YYYY-MM-DD | Plate CH Control (+): | 0.040475±0.00072 | Plate DMSO Control (-): | 0.6940500000000001±0.01190 | Plate Z-Factor: | 0.9523 |
| png ps pdf |
230884 |
(2R,3R,5S,8S,9S,10S,13S,14S,17S)-2,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-c yclopenta[a]phenanthrene-3,17-diol |
230920 |
(1S,2S,4R)-1,7,7-trimethylnorbornan-2-ol |
231025 |
1-(8,8-dimethyldecalin-2-yl)ethanol |
231026 |
1-(2,8,8-trimethyldecalin-2-yl)ethanol |
231044 |
n/a |
231050 |
n/a |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|