Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
DOC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4436±0.0359917 |
Normalized OD Score: sc h |
0.8050±0.0393794 |
Z-Score: |
-6.8570±1.14121 |
p-Value: |
0.000000000724202 |
Z-Factor: |
-0.166925 |
Fitness Defect: |
21.046 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.80 Celcius | Date: | 2008-05-09 YYYY-MM-DD | Plate CH Control (+): | 0.0412±0.00041 | Plate DMSO Control (-): | 0.540725±0.01962 | Plate Z-Factor: | 0.8859 |
| png ps pdf |
115830 |
3,3,4a-trimethyl-1,2,4,4b,5,6,7,8,8a,8b-decahydrobiphenylen-1-ol |
115852 |
n/a |
116699 |
1-(2,2,6-trimethylcyclohexyl)hexan-3-ol |
117419 |
[(1R,2S,5R)-6,6-dimethylnorpinan-2-yl]methanol |
118129 |
(2,2,6-trimethylcyclohexyl)methanol |
118193 |
(4-methylcyclohexyl)methanol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|