Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
VAM3 |
Replicates: |
2 |
Raw OD Value: r im |
0.4548±0.0281428 |
Normalized OD Score: sc h |
0.7132±0.0292421 |
Z-Score: |
-8.7029±0.485746 |
p-Value: |
3.15834e-17 |
Z-Factor: |
0.45294 |
Fitness Defect: |
37.9939 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2008-04-09 YYYY-MM-DD | Plate CH Control (+): | 0.03975±0.00124 | Plate DMSO Control (-): | 0.6302749999999999±0.01488 | Plate Z-Factor: | 0.8967 |
| png ps pdf |
8914 |
nonan-1-ol |
9027 |
3,6-dimethyloctan-3-ol |
10049 |
(1S,2R,4R)-1,7,7-trimethylnorbornan-2-ol |
10128 |
2,6,6-trimethylnorpinan-2-ol |
10353 |
2-(4-methylcyclohexyl)propan-2-ol |
10399 |
cycloheptanol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|