| Compound Information | SONAR Target prediction | | Name: | CEDROL | | Unique Identifier: | SPE00307059 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 197.168 g/mol | | X log p: | 0.0649999999999999 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | | Class: | sesquiterpene | | Source: | Common constitutent in the Family Cupressaceae | | Reference: | J Org Chem 43: 1964 (1978) | | Therapeutics: | acaricide | | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Drug_type: | Experimental | | Drugbank_id: | EXPT00530 | | Logp: | 3.73 | | Drug_category: | Sex Hormone-Binding Globulin inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7470±0.0189505 |
| Normalized OD Score: sc h |
0.8591±0.0174633 |
| Z-Score: |
-8.6853±1.16355 |
| p-Value: |
0.00000000000000188277 |
| Z-Factor: |
0.172888 |
| Fitness Defect: |
33.906 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 17|E7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.095±0.00538 | | Plate DMSO Control (-): | 0.95±0.02054 | | Plate Z-Factor: | 0.9179 |
|  png
ps
pdf |
| 15981575 |
(2S,3R,7R)-3,7-dimethyltridecan-2-ol |
| 16049918 |
(1S,4R)-5-deuterio-6-hydroxy-bicyclo[2.2.1]heptane |
| 16055632 |
(3S,4S,5S,8S,9S,10R,13R,14S,17R)-17-[(2R,5S)-5-ethyl-6-methyl-heptan-2-yl]-4,10,13-trimethyl-2,3,4,5,6,7
,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 16057425 |
[(1R,4R,5R)-1,7,7-trimethyl-5-bicyclo[2.2.1]heptyl]methanol |
| 16057429 |
(1R,3S,4S)-6,6-dimethylbicyclo[2.2.1]heptan-3-ol |
| 16057431 |
magnesium; decan-1-olate; propan-2-olate |
| internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
| active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|
