Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
GSY2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5599±0.0272943 |
Normalized OD Score: sc h |
0.8310±0.0275293 |
Z-Score: |
-7.9254±1.20914 |
p-Value: |
0.000000000000772104 |
Z-Factor: |
0.0444899 |
Fitness Defect: |
27.8897 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.00 Celcius | Date: | 2008-04-30 YYYY-MM-DD | Plate CH Control (+): | 0.040125±0.00043 | Plate DMSO Control (-): | 0.6641999999999999±0.01741 | Plate Z-Factor: | 0.9439 |
| png ps pdf |
12121995 |
(1S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-ol |
13109021 |
(2S,4S)-2,4,6-trimethylheptan-1-ol |
14512388 |
barium(+2) cation; 2-ethylhexan-1-olate |
15559396 |
(3S,8S,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,1 2,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
15605903 |
(1S,2S,4R)-4-methyl-2-propan-2-yl-cyclohexan-1-ol |
15939348 |
[(1S,5S,7R)-7-bicyclo[3.2.0]heptyl]methanol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|