Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
VPH1 |
Replicates: |
2 |
Raw OD Value: r im |
0.2802±0.0309006 |
Normalized OD Score: sc h |
0.6175±0.0340715 |
Z-Score: |
-6.8862±0.200946 |
p-Value: |
0.00000000000874652 |
Z-Factor: |
0.426057 |
Fitness Defect: |
25.4624 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.00 Celcius | Date: | 2008-03-01 YYYY-MM-DD | Plate CH Control (+): | 0.039650000000000005±0.00359 | Plate DMSO Control (-): | 0.440925±0.01662 | Plate Z-Factor: | 0.8719 |
| png ps pdf |
11626494 |
(3S,5R,8R,9R,10S,12R,13S,14R,17R)-4,4,8,10,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,7,9,11,1 2,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
11725710 |
7-hexyloctadecan-1-ol |
11725711 |
12-hexyloctadecan-1-ol |
11750021 |
(3S,5S,8S,9S,10S,13R,14S,17R)-17-[(2R,4R)-4-ethyl-5-methyl-hexan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11 ,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
11775746 |
n/a |
11775887 |
(2S,4aR,5S,8aR)-5-(hydroxymethyl)-1,1,4a-trimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|