Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
MT2481-pdr1pdr3-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.5371±0.0533159 |
Normalized OD Score: sc h |
0.5021±0.0922435 |
Z-Score: |
-20.9220±3.67727 |
p-Value: |
0 |
Z-Factor: |
0.309409 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|F9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2007-09-27 YYYY-MM-DD | Plate CH Control (+): | 0.03955±0.00134 | Plate DMSO Control (-): | 0.544125±0.13026 | Plate Z-Factor: | 0.1622 |
| png ps pdf |
7829989 |
(5R,8S,9S,10S,13R,14R,16R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta [a]phenanthren-16-ol |
10975445 |
(1R,4S,6S)-bicyclo[2.2.1]heptan-6-ol |
10975454 |
(1S)-2-methylcyclohexan-1-ol |
11075068 |
2-[(1R,4R,4aS,7S,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propan-2-ol |
11076083 |
(2S,3S)-3,7-dimethylpentadecan-2-ol |
11475087 |
n/a |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|