| Compound Information | SONAR Target prediction | | Name: | CEDROL | | Unique Identifier: | SPE00307059 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 197.168 g/mol | | X log p: | 0.0649999999999999 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | | Class: | sesquiterpene | | Source: | Common constitutent in the Family Cupressaceae | | Reference: | J Org Chem 43: 1964 (1978) | | Therapeutics: | acaricide | | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Drug_type: | Experimental | | Drugbank_id: | EXPT00530 | | Logp: | 3.73 | | Drug_category: | Sex Hormone-Binding Globulin inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
SKT5 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5083±0.0578413 |
| Normalized OD Score: sc h |
0.7536±0.0875734 |
| Z-Score: |
-12.2625±4.41735 |
| p-Value: |
3.15172e-20 |
| Z-Factor: |
-0.435538 |
| Fitness Defect: |
44.9038 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 24|C4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.30 Celcius | | Date: | 2008-06-17 YYYY-MM-DD | | Plate CH Control (+): | 0.0407±0.00064 | | Plate DMSO Control (-): | 0.6703250000000001±0.01837 | | Plate Z-Factor: | 0.9175 |
|  png
ps
pdf |
| 7227303 |
4-[(1R,2S,4R,6R)-5,5,6-trimethylnorbornan-2-yl]cyclohexan-1-ol |
| 7269374 |
n/a |
| 7271789 |
(1S,2S,3R)-2,3-dimethylcyclohexan-1-ol |
| 7271790 |
(1R,2S,3R)-2,3-dimethylcyclohexan-1-ol |
| 7271791 |
(1R,2S,3S)-2,3-dimethylcyclohexan-1-ol |
| 7271803 |
(1S,2R,3R,5R)-2,6,6-trimethylnorpinan-3-ol |
| internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
| active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|
