Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SKT5 |
Replicates: |
2 |
Raw OD Value: r im |
0.5083±0.0578413 |
Normalized OD Score: sc h |
0.7536±0.0875734 |
Z-Score: |
-12.2625±4.41735 |
p-Value: |
3.15172e-20 |
Z-Factor: |
-0.435538 |
Fitness Defect: |
44.9038 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.30 Celcius | Date: | 2008-06-17 YYYY-MM-DD | Plate CH Control (+): | 0.0407±0.00064 | Plate DMSO Control (-): | 0.6703250000000001±0.01837 | Plate Z-Factor: | 0.9175 |
| png ps pdf |
7052666 |
(3S,5S,8S,9R,10R,13R,14R,17R)-3-ethyl-5,10,13-trimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyc lopenta[a]phenanthrene-3,17-diol |
7052667 |
(3S,5S,8S,9R,10S,13R,14R,17R)-3-ethyl-5,10,13-trimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyc lopenta[a]phenanthrene-3,17-diol |
7052668 |
(3S,5S,8S,9S,10R,13R,14R,17R)-3-ethyl-5,10,13-trimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyc lopenta[a]phenanthrene-3,17-diol |
7052669 |
(3S,5S,8S,9S,10S,13R,14R,17R)-3-ethyl-5,10,13-trimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyc lopenta[a]phenanthrene-3,17-diol |
7054164 |
(1S,3S)-1-ethyl-3-methyl-cyclohexan-1-ol |
7054165 |
(1R,3S)-1-ethyl-3-methyl-cyclohexan-1-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|