Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
QCR8 |
Replicates: |
2 |
Raw OD Value: r im |
0.4291±0.0251023 |
Normalized OD Score: sc h |
0.6689±0.0203641 |
Z-Score: |
-13.6930±0.833302 |
p-Value: |
1.56567e-39 |
Z-Factor: |
0.632241 |
Fitness Defect: |
89.3525 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2008-04-25 YYYY-MM-DD | Plate CH Control (+): | 0.039775000000000005±0.00128 | Plate DMSO Control (-): | 0.63675±0.01281 | Plate Z-Factor: | 0.9384 |
| png ps pdf |
7052494 |
(5R,8S,9R,10R,13S,14S,17R)-5,10,13,14-tetramethyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta [a]phenanthren-17-ol |
7052495 |
(5R,8S,9R,10S,13S,14S,17R)-5,10,13,14-tetramethyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta [a]phenanthren-17-ol |
7052496 |
(5R,8S,9S,10R,13S,14S,17R)-5,10,13,14-tetramethyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta [a]phenanthren-17-ol |
7052497 |
(5R,8S,9S,10S,13S,14S,17R)-5,10,13,14-tetramethyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta [a]phenanthren-17-ol |
7052518 |
(3R,5S,8S,9S,10R,13S,14S)-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a ]phenanthren-3-ol |
7052519 |
(3R,5S,8S,9S,10R,13R,14S)-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a ]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|