Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
MMS22 |
Replicates: |
2 |
Raw OD Value: r im |
0.3157±0.0461034 |
Normalized OD Score: sc h |
0.6284±0.0715438 |
Z-Score: |
-12.1512±1.6764 |
p-Value: |
2.79138e-28 |
Z-Factor: |
0.166849 |
Fitness Defect: |
63.4458 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2008-06-13 YYYY-MM-DD | Plate CH Control (+): | 0.041124999999999995±0.00085 | Plate DMSO Control (-): | 0.51705±0.01567 | Plate Z-Factor: | 0.8885 |
| png ps pdf |
6431626 |
(1R,2S)-1-methyl-2-tert-butyl-cyclohexan-1-ol |
6431628 |
(1R,4R)-4-methyl-1-propan-2-yl-bicyclo[3.1.0]hexan-4-ol |
6431934 |
(1S,2R,5R)-2-methyl-5-propan-2-yl-cyclohexan-1-ol |
6432196 |
(3R,5R,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene -3,17-diol |
6432197 |
(3R,5S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene -3,17-diol |
6432213 |
(3S)-17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1 H-cyclopenta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|