Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
MED2 |
Replicates: |
2 |
Raw OD Value: r im |
0.4705±0.0296278 |
Normalized OD Score: sc h |
0.8476±0.0445971 |
Z-Score: |
-6.7255±2.07247 |
p-Value: |
0.0000000720116 |
Z-Factor: |
-0.924945 |
Fitness Defect: |
16.4464 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.30 Celcius | Date: | 2008-04-29 YYYY-MM-DD | Plate CH Control (+): | 0.0406±0.00046 | Plate DMSO Control (-): | 0.5464249999999999±0.02599 | Plate Z-Factor: | 0.8902 |
| png ps pdf |
6429856 |
(3S,5R,17R)-10,13,17-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene- 3,17-diol |
6429895 |
(3R,5R,7R,17S)-7,10,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenan threne-3,17-diol |
6429897 |
(3R,5R,7R,17R)-7,10,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenan threne-3,17-diol |
6430690 |
1-[(1S,3aR,7S,7aS)-7,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-propan-1-ol |
6430999 |
(2S)-2,7,7-trimethylnorbornan-1-ol |
6431133 |
n/a |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|