Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
CHS3 |
Replicates: |
2 |
Raw OD Value: r im |
0.4571±0.0521845 |
Normalized OD Score: sc h |
0.7003±0.07569 |
Z-Score: |
-13.8268±3.17386 |
p-Value: |
2.52758e-31 |
Z-Factor: |
0.022475 |
Fitness Defect: |
70.4529 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.50 Celcius | Date: | 2008-06-20 YYYY-MM-DD | Plate CH Control (+): | 0.040325±0.00078 | Plate DMSO Control (-): | 0.6517±0.01347 | Plate Z-Factor: | 0.9316 |
| png ps pdf |
4054783 |
18-heptadecylhexatriacontan-18-ol |
4071557 |
3-methyladamantan-1-ol |
4090063 |
n/a |
4092370 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a ]phenanthren-2-ol |
4101370 |
10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysene-1,8-diol |
4116638 |
3-ethyldodecan-3-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|