Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BNI4 |
Replicates: |
2 |
Raw OD Value: r im |
0.5150±0.0221324 |
Normalized OD Score: sc h |
0.8297±0.0209775 |
Z-Score: |
-5.3119±1.07016 |
p-Value: |
0.00000261788 |
Z-Factor: |
0.202025 |
Fitness Defect: |
12.8531 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|F9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.10 Celcius | Date: | 2006-03-22 YYYY-MM-DD | Plate CH Control (+): | 0.03955±0.00070 | Plate DMSO Control (-): | 0.640825±0.01531 | Plate Z-Factor: | 0.9537 |
| png ps pdf |
41559 |
7-methylheptadecan-7-ol |
42263 |
heptadecan-2-ol |
42265 |
2-methyldodecan-1-ol |
45056 |
(1S,2R,5R)-5-methyl-2-propan-2-yl-cyclohexan-1-ol |
61056 |
2,6,8-trimethylnonan-4-ol |
61060 |
(1R,2R,4S)-1,7,7-trimethylnorbornan-2-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|