Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
CLA4 |
Replicates: |
2 |
Raw OD Value: r im |
0.5997±0.0424971 |
Normalized OD Score: sc h |
0.8836±0.0477157 |
Z-Score: |
-5.1738±2.30283 |
p-Value: |
0.000195984 |
Z-Factor: |
-2.32355 |
Fitness Defect: |
8.5375 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|F9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.70 Celcius | Date: | 2007-09-12 YYYY-MM-DD | Plate CH Control (+): | 0.040325±0.00053 | Plate DMSO Control (-): | 0.6646±0.04595 | Plate Z-Factor: | 0.7654 |
| png ps pdf |
1797953 |
[(1R,2R,4S)-1,2,4-trimethylcyclohexyl]methanol |
1810448 |
(1S)-1-cyclopentylpropan-1-ol |
1810450 |
(1R)-1-cyclopentylpropan-1-ol |
1859428 |
n/a |
1859535 |
(1R,2S,5R)-5-methyl-2-propyl-cyclohexan-1-ol |
1861895 |
(3S,11R)-tridecane-3,11-diol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|