Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
FKS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4887±0.057912 |
Normalized OD Score: sc h |
0.8613±0.0881895 |
Z-Score: |
-6.0211±3.65318 |
p-Value: |
0.00029316 |
Z-Factor: |
-1.56501 |
Fitness Defect: |
8.1348 |
Bioactivity Statement: |
Outlier |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|F9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.40 Celcius | Date: | 2006-04-11 YYYY-MM-DD | Plate CH Control (+): | 0.0395±0.00209 | Plate DMSO Control (-): | 0.57±0.03413 | Plate Z-Factor: | 0.8061 |
| png ps pdf |
600832 |
4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,3,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-hexadecahydropicen-6-ol |
605867 |
4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-ol |
606487 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a ]phenanthrene-3,11-diol |
609507 |
n/a |
609544 |
n/a |
609979 |
4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta [a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|