Compound Information | SONAR Target prediction | Name: | CEDROL | Unique Identifier: | SPE00307059 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 197.168 g/mol | X log p: | 0.0649999999999999 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(C)(C)C3CC12CCC3(C)O | Class: | sesquiterpene | Source: | Common constitutent in the Family Cupressaceae | Reference: | J Org Chem 43: 1964 (1978) | Therapeutics: | acaricide | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BIM1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6052±0.0127986 |
Normalized OD Score: sc h |
0.9041±0.0209656 |
Z-Score: |
-4.8822±0.673774 |
p-Value: |
0.00000531296 |
Z-Factor: |
-0.221481 |
Fitness Defect: |
12.1454 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.70 Celcius | Date: | 2008-06-24 YYYY-MM-DD | Plate CH Control (+): | 0.040025000000000005±0.00163 | Plate DMSO Control (-): | 0.657675±0.01287 | Plate Z-Factor: | 0.9225 |
| png ps pdf |
443480 |
n/a |
444637 |
(3S,7S,11S)-3,7,11,15-tetramethylhexadecan-1-ol |
445071 |
(5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta [a]phenanthrene-3,17-diol |
445183 |
(6S)-2,6-dimethyloctan-2-ol |
445558 |
(3S)-3,7-dimethyl-9-[(1R)-2,2,6-trimethylcyclohexyl]nonan-1-ol |
445789 |
(3R)-octan-3-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 4444 | Additional Members: 3 | Rows returned: 1 | |
|