| Compound Information | SONAR Target prediction | | Name: | BISABOLOL ACETATE | | Unique Identifier: | SPE00307058 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 236.181 g/mol | | X log p: | 4.408 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | CC(=O)OC(C)(CCC=C(C)C)C1CCC(C)=CC1 | | Class: | sesquiterpene | | Source: | derivative |
| Species: |
4932 |
| Condition: |
GCN5 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2583±0.00997021 |
| Normalized OD Score: sc h |
1.0051±0.0353767 |
| Z-Score: |
0.0862±0.605818 |
| p-Value: |
0.669532 |
| Z-Factor: |
-125.725 |
| Fitness Defect: |
0.4012 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|F8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.30 Celcius | | Date: | 2007-10-30 YYYY-MM-DD | | Plate CH Control (+): | 0.041249999999999995±0.00086 | | Plate DMSO Control (-): | 0.2702±0.02776 | | Plate Z-Factor: | 0.6896 |
|  png
ps
pdf |
| 90792 |
2-(6-bicyclo[2.2.1]hept-2-enyl)propan-2-yl acetate |
| 93317 |
2-[(1S)-4-methyl-1-cyclohex-3-enyl]propan-2-yl acetate |
| 106749 |
(2,4-dimethyl-1-cyclohex-3-enyl)methyl acetate |
| 111037 |
2-(4-methyl-1-cyclohex-3-enyl)propan-2-yl acetate |
| 112702 |
1-(4,6,6-trimethyl-1-cyclohex-3-enyl)ethyl acetate |
| 174897 |
n/a |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 11864 | Additional Members: 1 | Rows returned: 0 | |
|
