Compound Information | SONAR Target prediction | Name: | DEHYDROABIETAMIDE | Unique Identifier: | SPE00307050 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 270.22 g/mol | X log p: | 6.033 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(C)c1ccc2c(CCC3C(C)(CCCC32C)C(N)=O)c1 | Class: | diterpene | Source: | derivative |
Species: |
4932 |
Condition: |
MRT4 |
Replicates: |
2 |
Raw OD Value: r im |
0.4270±0.044477 |
Normalized OD Score: sc h |
0.8557±0.0202313 |
Z-Score: |
-4.8432±1.36972 |
p-Value: |
0.000053383 |
Z-Factor: |
-1.80161 |
Fitness Defect: |
9.838 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|F4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.00 Celcius | Date: | 2007-08-30 YYYY-MM-DD | Plate CH Control (+): | 0.0392±0.00085 | Plate DMSO Control (-): | 0.488975±0.07106 | Plate Z-Factor: | 0.5274 |
| png ps pdf |
DBLink | Rows returned: 1 | |
3983547 |
1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 7722 | Additional Members: 4 | Rows returned: 1 | |
|