| Compound Information | SONAR Target prediction | | Name: | DEHYDROABIETAMIDE | | Unique Identifier: | SPE00307050 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 270.22 g/mol | | X log p: | 6.033 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(C)c1ccc2c(CCC3C(C)(CCCC32C)C(N)=O)c1 | | Class: | diterpene | | Source: | derivative |
| Species: |
4932 |
| Condition: |
RVS167 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7102±0.00346482 |
| Normalized OD Score: sc h |
0.9721±0.00233607 |
| Z-Score: |
-1.5516±0.0738799 |
| p-Value: |
0.121276 |
| Z-Factor: |
-1.27753 |
| Fitness Defect: |
2.1097 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|F4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.70 Celcius | | Date: | 2007-11-14 YYYY-MM-DD | | Plate CH Control (+): | 0.041175±0.00083 | | Plate DMSO Control (-): | 0.717975±0.01481 | | Plate Z-Factor: | 0.9279 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 3983547 |
1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7722 | Additional Members: 4 | Rows returned: 1 | |
|